C17H18F2Si — CID 139792198
4,4-difluoro-1,1-diphenylsilinane (PubChem CID 139792198) has the molecular formula C17H18F2Si and a molecular weight of 288.41 g/mol. Its IUPAC name is 4,4-difluoro-1,1-diphenylsilinane.
| Compound Name | 4,4-difluoro-1,1-diphenylsilinane |
|---|---|
| PubChem CID | 139792198 |
| Molecular Formula | C17H18F2Si |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4,4-difluoro-1,1-diphenylsilinane |
| SMILES | FC1(F)CC[Si](c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H18F2Si/c18-17(19)11-13-20(14-12-17,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | YGWOTJWKPSNPJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|