C30H26F6Si2 — CID 102352325
(1S,2R)-1,2-diphenyl-1,2-bis[4-(trifluoromethyl)phenyl]disilinane (PubChem CID 102352325) has the molecular formula C30H26F6Si2 and a molecular weight of 556.70 g/mol. Its IUPAC name is (1S,2R)-1,2-diphenyl-1,2-bis[4-(trifluoromethyl)phenyl]disilinane.
| Compound Name | (1S,2R)-1,2-diphenyl-1,2-bis[4-(trifluoromethyl)phenyl]disilinane |
|---|---|
| PubChem CID | 102352325 |
| Molecular Formula | C30H26F6Si2 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | (1S,2R)-1,2-diphenyl-1,2-bis[4-(trifluoromethyl)phenyl]disilinane |
| SMILES | FC(F)(F)c1ccc([Si@@]2(c3ccccc3)CCCC[Si@@]2(c2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H26F6Si2/c31-29(32,33)23-13-17-27(18-14-23)37(25-9-3-1-4-10-25)21-7-8-22-38(37,26-11-5-2-6-12-26)28-19-15-24(16-20-28)30(34,35)36/h1-6,9-20H,7-8,21-22H2/t37-,38+ |
| InChIKey | PVDWKANABMPPFF-MAZIBIHTSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|