C19H14B3F3O3 — CID 20654598
2,4-diphenyl-6-[4-(trifluoromethyl)phenyl]-1,3,5,2,4,6-trioxatriborinane (PubChem CID 20654598) has the molecular formula C19H14B3F3O3 and a molecular weight of 379.75 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-(trifluoromethyl)phenyl]-1,3,5,2,4,6-trioxatriborinane.
| Compound Name | 2,4-diphenyl-6-[4-(trifluoromethyl)phenyl]-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| PubChem CID | 20654598 |
| Molecular Formula | C19H14B3F3O3 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2,4-diphenyl-6-[4-(trifluoromethyl)phenyl]-1,3,5,2,4,6-trioxatriborinane |
| SMILES | FC(F)(F)c1ccc(B2OB(c3ccccc3)OB(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C19H14B3F3O3/c23-19(24,25)15-11-13-18(14-12-15)22-27-20(16-7-3-1-4-8-16)26-21(28-22)17-9-5-2-6-10-17/h1-14H |
| InChIKey | FTHJCCXGUFQPSE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|