C36H27B3O6 — CID 11006440
2,4,6-tris(4-phenoxyphenyl)-1,3,5,2,4,6-trioxatriborinane (PubChem CID 11006440) has the molecular formula C36H27B3O6 and a molecular weight of 588.04 g/mol. Its IUPAC name is 2,4,6-tris(4-phenoxyphenyl)-1,3,5,2,4,6-trioxatriborinane.
| Compound Name | 2,4,6-tris(4-phenoxyphenyl)-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| PubChem CID | 11006440 |
| Molecular Formula | C36H27B3O6 |
| Molecular Weight | 588.04 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2,4,6-tris(4-phenoxyphenyl)-1,3,5,2,4,6-trioxatriborinane |
| SMILES | c1ccc(Oc2ccc(B3OB(c4ccc(Oc5ccccc5)cc4)OB(c4ccc(Oc5ccccc5)cc4)O3)cc2)cc1 |
| InChI | InChI=1S/C36H27B3O6/c1-4-10-31(11-5-1)40-34-22-16-28(17-23-34)37-43-38(29-18-24-35(25-19-29)41-32-12-6-2-7-13-32)45-39(44-37)30-20-26-36(27-21-30)42-33-14-8-3-9-15-33/h1-27H |
| InChIKey | NUUHRSBKLDBUSE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.04 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|