C28H28Si2 — CID 86071177
1,1,2,2-tetraphenyldisilinane (PubChem CID 86071177) has the molecular formula C28H28Si2 and a molecular weight of 420.70 g/mol. Its IUPAC name is 1,1,2,2-tetraphenyldisilinane.
| Compound Name | 1,1,2,2-tetraphenyldisilinane |
|---|---|
| PubChem CID | 86071177 |
| Molecular Formula | C28H28Si2 |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1,1,2,2-tetraphenyldisilinane |
| SMILES | c1ccc([Si]2(c3ccccc3)CCCC[Si]2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28Si2/c1-5-15-25(16-6-1)29(26-17-7-2-8-18-26)23-13-14-24-30(29,27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22H,13-14,23-24H2 |
| InChIKey | IGLQWXPWWHTVNT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|