C24H40Si4 — CID 11729896
1,1,2,6,6,7-hexamethyl-2,7-diphenyl-1,2,6,7-tetrasilecane (PubChem CID 11729896) has the molecular formula C24H40Si4 and a molecular weight of 440.93 g/mol. Its IUPAC name is 1,1,2,6,6,7-hexamethyl-2,7-diphenyl-1,2,6,7-tetrasilecane.
| Compound Name | 1,1,2,6,6,7-hexamethyl-2,7-diphenyl-1,2,6,7-tetrasilecane |
|---|---|
| PubChem CID | 11729896 |
| Molecular Formula | C24H40Si4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1,1,2,6,6,7-hexamethyl-2,7-diphenyl-1,2,6,7-tetrasilecane |
| SMILES | C[Si]1(C)CCC[Si](C)(c2ccccc2)[Si](C)(C)CCC[Si]1(C)c1ccccc1 |
| InChI | InChI=1S/C24H40Si4/c1-25(2)19-13-22-28(6,24-17-11-8-12-18-24)26(3,4)20-14-21-27(25,5)23-15-9-7-10-16-23/h7-12,15-18H,13-14,19-22H2,1-6H3 |
| InChIKey | BTPKEMWJDLBQKC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|