C32H34Si2 — CID 15499078
(1S,2Z,4R)-1,4-dimethyl-1,2,3,4-tetraphenyl-5,6,7,8-tetrahydro-1,4-disilocine (PubChem CID 15499078) has the molecular formula C32H34Si2 and a molecular weight of 474.80 g/mol. Its IUPAC name is (1S,2Z,4R)-1,4-dimethyl-1,2,3,4-tetraphenyl-5,6,7,8-tetrahydro-1,4-disilocine.
| Compound Name | (1S,2Z,4R)-1,4-dimethyl-1,2,3,4-tetraphenyl-5,6,7,8-tetrahydro-1,4-disilocine |
|---|---|
| PubChem CID | 15499078 |
| Molecular Formula | C32H34Si2 |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1S,2Z,4R)-1,4-dimethyl-1,2,3,4-tetraphenyl-5,6,7,8-tetrahydro-1,4-disilocine |
| SMILES | C[Si@]1(c2ccccc2)CCCC[Si@@](C)(c2ccccc2)/C(c2ccccc2)=C\1c1ccccc1 |
| InChI | InChI=1S/C32H34Si2/c1-33(29-21-11-5-12-22-29)25-15-16-26-34(2,30-23-13-6-14-24-30)32(28-19-9-4-10-20-28)31(33)27-17-7-3-8-18-27/h3-14,17-24H,15-16,25-26H2,1-2H3/b32-31-/t33-,34+ |
| InChIKey | SMWRSDOCTDDTNG-FWGVWXSPSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|