C70H56O4Si4 — CID 122232420
7,15-dimethyl-1,2,3,4,7,10,11,12,13,15-decakis-phenyl-6,8,14,16-tetraoxa-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadeca-1,3,10,12-tetraene (PubChem CID 122232420) has the molecular formula C70H56O4Si4 and a molecular weight of 1073.56 g/mol. Its IUPAC name is 7,15-dimethyl-1,2,3,4,7,10,11,12,13,15-decakis-phenyl-6,8,14,16-tetraoxa-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadeca-1,3,10,12-tetraene.
| Compound Name | 7,15-dimethyl-1,2,3,4,7,10,11,12,13,15-decakis-phenyl-6,8,14,16-tetraoxa-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadeca-1,3,10,12-tetraene |
|---|---|
| PubChem CID | 122232420 |
| Molecular Formula | C70H56O4Si4 |
| Molecular Weight | 1073.56 g/mol |
| Exact Mass | 1072.33 |
| IUPAC Name | 7,15-dimethyl-1,2,3,4,7,10,11,12,13,15-decakis-phenyl-6,8,14,16-tetraoxa-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadeca-1,3,10,12-tetraene |
| SMILES | C[Si@]1(c2ccccc2)O[Si]2(O[Si@](C)(c3ccccc3)O[Si]3(O1)C(c1ccccc1)=C(c1ccccc1)C(c1ccccc1)=C3c1ccccc1)C(c1ccccc1)=C(c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C70H56O4Si4/c1-75(61-49-29-11-30-50-61)71-77(67(57-41-21-7-22-42-57)63(53-33-13-3-14-34-53)64(54-35-15-4-16-36-54)68(77)58-43-23-8-24-44-58)73-76(2,62-51-31-12-32-52-62)74-78(72-75)69(59-45-25-9-26-46-59)65(55-37-17-5-18-38-55)66(56-39-19-6-20-40-56)70(78)60-47-27-10-28-48-60/h3-52H,1-2H3/t75-,76- |
| InChIKey | BVCMIZJUXMEYFU-YEZLLYRCSA-N |
| XLogP | 15.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.56 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|