C60H50Si2 — CID 13131416
1-methyl-1-[2-(1-methyl-2,3,4,5-tetraphenylsilol-1-yl)ethyl]-2,3,4,5-tetraphenylsilole (PubChem CID 13131416) has the molecular formula C60H50Si2 and a molecular weight of 827.23 g/mol. Its IUPAC name is 1-methyl-1-[2-(1-methyl-2,3,4,5-tetraphenylsilol-1-yl)ethyl]-2,3,4,5-tetraphenylsilole.
| Compound Name | 1-methyl-1-[2-(1-methyl-2,3,4,5-tetraphenylsilol-1-yl)ethyl]-2,3,4,5-tetraphenylsilole |
|---|---|
| PubChem CID | 13131416 |
| Molecular Formula | C60H50Si2 |
| Molecular Weight | 827.23 g/mol |
| Exact Mass | 826.35 |
| IUPAC Name | 1-methyl-1-[2-(1-methyl-2,3,4,5-tetraphenylsilol-1-yl)ethyl]-2,3,4,5-tetraphenylsilole |
| SMILES | C[Si]1(CC[Si]2(C)C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C60H50Si2/c1-61(57(49-35-19-7-20-36-49)53(45-27-11-3-12-28-45)54(46-29-13-4-14-30-46)58(61)50-37-21-8-22-38-50)43-44-62(2)59(51-39-23-9-24-40-51)55(47-31-15-5-16-32-47)56(48-33-17-6-18-34-48)60(62)52-41-25-10-26-42-52/h3-42H,43-44H2,1-2H3 |
| InChIKey | KKIWHCCEDIDTBA-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.23 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|