C20H22Si — CID 15329320
1,1,2,3-tetramethyl-4,5-diphenylsilole (PubChem CID 15329320) has the molecular formula C20H22Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 1,1,2,3-tetramethyl-4,5-diphenylsilole.
| Compound Name | 1,1,2,3-tetramethyl-4,5-diphenylsilole |
|---|---|
| PubChem CID | 15329320 |
| Molecular Formula | C20H22Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,1,2,3-tetramethyl-4,5-diphenylsilole |
| SMILES | CC1=C(C)[Si](C)(C)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C20H22Si/c1-15-16(2)21(3,4)20(18-13-9-6-10-14-18)19(15)17-11-7-5-8-12-17/h5-14H,1-4H3 |
| InChIKey | CYECPMGBYIZPOY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|