C30H28N2Si — CID 170897442
4-[5-(4-aminophenyl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]aniline (PubChem CID 170897442) has the molecular formula C30H28N2Si and a molecular weight of 444.65 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]aniline.
| Compound Name | 4-[5-(4-aminophenyl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]aniline |
|---|---|
| PubChem CID | 170897442 |
| Molecular Formula | C30H28N2Si |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[5-(4-aminophenyl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]aniline |
| SMILES | C[Si]1(C)C(c2ccc(N)cc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc(N)cc1 |
| InChI | InChI=1S/C30H28N2Si/c1-33(2)29(23-13-17-25(31)18-14-23)27(21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)30(33)24-15-19-26(32)20-16-24/h3-20H,31-32H2,1-2H3 |
| InChIKey | SYHDXBXMTFFLDS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|