C34H26S2Si — CID 122365519
5-[5-(1-benzothiophen-5-yl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]-1-benzothiophene (PubChem CID 122365519) has the molecular formula C34H26S2Si and a molecular weight of 526.80 g/mol. Its IUPAC name is 5-[5-(1-benzothiophen-5-yl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]-1-benzothiophene.
| Compound Name | 5-[5-(1-benzothiophen-5-yl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 122365519 |
| Molecular Formula | C34H26S2Si |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 5-[5-(1-benzothiophen-5-yl)-1,1-dimethyl-3,4-diphenylsilol-2-yl]-1-benzothiophene |
| SMILES | C[Si]1(C)C(c2ccc3sccc3c2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc2sccc2c1 |
| InChI | InChI=1S/C34H26S2Si/c1-37(2)33(27-13-15-29-25(21-27)17-19-35-29)31(23-9-5-3-6-10-23)32(24-11-7-4-8-12-24)34(37)28-14-16-30-26(22-28)18-20-36-30/h3-22H,1-2H3 |
| InChIKey | DXKXKUZERPKZPL-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|