C52H36S2Si — CID 102191393
2-(2,3,6,7,8,9-hexakis-phenyl-4-thiophen-2-yl-5-silaspiro[4.4]nona-1,3,6,8-tetraen-1-yl)thiophene (PubChem CID 102191393) has the molecular formula C52H36S2Si and a molecular weight of 753.08 g/mol. Its IUPAC name is 2-(2,3,6,7,8,9-hexakis-phenyl-4-thiophen-2-yl-5-silaspiro[4.4]nona-1,3,6,8-tetraen-1-yl)thiophene.
| Compound Name | 2-(2,3,6,7,8,9-hexakis-phenyl-4-thiophen-2-yl-5-silaspiro[4.4]nona-1,3,6,8-tetraen-1-yl)thiophene |
|---|---|
| PubChem CID | 102191393 |
| Molecular Formula | C52H36S2Si |
| Molecular Weight | 753.08 g/mol |
| Exact Mass | 752.20 |
| IUPAC Name | 2-(2,3,6,7,8,9-hexakis-phenyl-4-thiophen-2-yl-5-silaspiro[4.4]nona-1,3,6,8-tetraen-1-yl)thiophene |
| SMILES | c1ccc(C2=C(c3ccccc3)[Si]3(C(c4ccccc4)=C2c2ccccc2)C(c2cccs2)=C(c2ccccc2)C(c2ccccc2)=C3c2cccs2)cc1 |
| InChI | InChI=1S/C52H36S2Si/c1-7-21-37(22-8-1)45-46(38-23-9-2-10-24-38)50(42-31-17-6-18-32-42)55(49(45)41-29-15-5-16-30-41)51(43-33-19-35-53-43)47(39-25-11-3-12-26-39)48(40-27-13-4-14-28-40)52(55)44-34-20-36-54-44/h1-36H |
| InChIKey | GTXQWWIFBIIMIQ-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.08 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|