C48H33NS3 — CID 175210688
5-phenyl-N,N-bis(5-phenyl-2-thiophen-2-ylphenyl)-2-thiophen-2-ylaniline (PubChem CID 175210688) has the molecular formula C48H33NS3 and a molecular weight of 720.00 g/mol. Its IUPAC name is 5-phenyl-N,N-bis(5-phenyl-2-thiophen-2-ylphenyl)-2-thiophen-2-ylaniline.
| Compound Name | 5-phenyl-N,N-bis(5-phenyl-2-thiophen-2-ylphenyl)-2-thiophen-2-ylaniline |
|---|---|
| PubChem CID | 175210688 |
| Molecular Formula | C48H33NS3 |
| Molecular Weight | 720.00 g/mol |
| Exact Mass | 719.18 |
| IUPAC Name | 5-phenyl-N,N-bis(5-phenyl-2-thiophen-2-ylphenyl)-2-thiophen-2-ylaniline |
| SMILES | c1ccc(-c2ccc(-c3cccs3)c(N(c3cc(-c4ccccc4)ccc3-c3cccs3)c3cc(-c4ccccc4)ccc3-c3cccs3)c2)cc1 |
| InChI | InChI=1S/C48H33NS3/c1-4-13-34(14-5-1)37-22-25-40(46-19-10-28-50-46)43(31-37)49(44-32-38(35-15-6-2-7-16-35)23-26-41(44)47-20-11-29-51-47)45-33-39(36-17-8-3-9-18-36)24-27-42(45)48-21-12-30-52-48/h1-33H |
| InChIKey | ZKPNXTLNACPCHL-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.00 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |