C29H23ClSi — CID 12722878
1-chloro-1-methyl-2,3,4,5-tetraphenylsilole (PubChem CID 12722878) has the molecular formula C29H23ClSi and a molecular weight of 435.04 g/mol. Its IUPAC name is 1-chloro-1-methyl-2,3,4,5-tetraphenylsilole.
| Compound Name | 1-chloro-1-methyl-2,3,4,5-tetraphenylsilole |
|---|---|
| PubChem CID | 12722878 |
| Molecular Formula | C29H23ClSi |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1-chloro-1-methyl-2,3,4,5-tetraphenylsilole |
| SMILES | C[Si]1(Cl)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H23ClSi/c1-31(30)28(24-18-10-4-11-19-24)26(22-14-6-2-7-15-22)27(23-16-8-3-9-17-23)29(31)25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | XJVXSKVTJUPZPV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|