C34H35ClSi2 — CID 101263165
tert-butyl-(1-chloro-2,3,4,5-tetraphenylsilol-1-yl)-dimethylsilane (PubChem CID 101263165) has the molecular formula C34H35ClSi2 and a molecular weight of 535.28 g/mol. Its IUPAC name is tert-butyl-(1-chloro-2,3,4,5-tetraphenylsilol-1-yl)-dimethylsilane.
| Compound Name | tert-butyl-(1-chloro-2,3,4,5-tetraphenylsilol-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 101263165 |
| Molecular Formula | C34H35ClSi2 |
| Molecular Weight | 535.28 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | tert-butyl-(1-chloro-2,3,4,5-tetraphenylsilol-1-yl)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)[Si]1(Cl)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C34H35ClSi2/c1-34(2,3)36(4,5)37(35)32(28-22-14-8-15-23-28)30(26-18-10-6-11-19-26)31(27-20-12-7-13-21-27)33(37)29-24-16-9-17-25-29/h6-25H,1-5H3 |
| InChIKey | SZSJBOBHWIKBJS-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.28 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|