C41H47P — CID 178070741
tritert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-ylidene)-λ5-phosphane (PubChem CID 178070741) has the molecular formula C41H47P and a molecular weight of 570.80 g/mol. Its IUPAC name is tritert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-ylidene)-λ5-phosphane.
| Compound Name | tritert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-ylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 178070741 |
| Molecular Formula | C41H47P |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | tritert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-ylidene)-λ5-phosphane |
| SMILES | CC(C)(C)P(=C1C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C41H47P/c1-39(2,3)42(40(4,5)6,41(7,8)9)38-36(32-26-18-12-19-27-32)34(30-22-14-10-15-23-30)35(31-24-16-11-17-25-31)37(38)33-28-20-13-21-29-33/h10-29H,1-9H3 |
| InChIKey | VLJBOCIIIDAJCF-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|