About tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane
tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane (PubChem CID 177401963) has the molecular formula C28H40PbSi2
and a molecular weight of 640.00 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane |
| PubChem CID | 177401963 |
| Molecular Formula | C28H40PbSi2 |
| Molecular Weight | 640.00 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C1=C(c2ccccc2)C(c2ccccc2)=C([Si](C)(C)C(C)(C)C)[Pb]1 |
| InChI | InChI=1S/C28H40Si2.Pb/c1-27(2,3)29(7,8)21-25(23-17-13-11-14-18-23)26(24-19-15-12-16-20-24)22-30(9,10)28(4,5)6;/h11-20H,1-10H3; |
| InChIKey | RDNZIRVDNQZYJX-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.00 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane?
The IUPAC name of tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane (CID 177401963) is tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane.
What is the SMILES notation for tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane?
The canonical SMILES for tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane is CC(C)(C)[Si](C)(C)C1=C(c2ccccc2)C(c2ccccc2)=C([Si](C)(C)C(C)(C)C)[Pb]1.
What is the InChIKey of tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane?
The InChIKey is RDNZIRVDNQZYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40Si2.Pb/c1-27(2,3)29(7,8)21-25(23-17-13-11-14-18-23)26(24-19-15-12-16-20-24)22-30(9,10)28(4,5)6;/h11-20H,1-10H3;.
What are the key properties of tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane?
tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane has a molecular weight of 640.00 g/mol, XLogP of 8.62, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[5-[tert-butyl(dimethyl)silyl]-3,4-diphenyl-1λ2-plumbol-2-yl]-dimethylsilane is sourced from PubChem (CID 177401963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).