C24H39Si3- — CID 177457870
bis[tert-butyl(dimethyl)silyl]-(4-phenylphenyl)silanide (PubChem CID 177457870) has the molecular formula C24H39Si3- and a molecular weight of 411.83 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl]-(4-phenylphenyl)silanide.
| Compound Name | bis[tert-butyl(dimethyl)silyl]-(4-phenylphenyl)silanide |
|---|---|
| PubChem CID | 177457870 |
| Molecular Formula | C24H39Si3- |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl]-(4-phenylphenyl)silanide |
| SMILES | CC(C)(C)[Si](C)(C)[Si-](c1ccc(-c2ccccc2)cc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H39Si3/c1-23(2,3)26(7,8)25(27(9,10)24(4,5)6)22-18-16-21(17-19-22)20-14-12-11-13-15-20/h11-19H,1-10H3/q-1 |
| InChIKey | KABWQVKAQFPRQM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|