C35H38Si2 — CID 54515574
ethyl-[(1-ethyl-2,3,4,5-tetraphenylsilol-1-yl)methyl]-dimethylsilane (PubChem CID 54515574) has the molecular formula C35H38Si2 and a molecular weight of 514.86 g/mol. Its IUPAC name is ethyl-[(1-ethyl-2,3,4,5-tetraphenylsilol-1-yl)methyl]-dimethylsilane.
| Compound Name | ethyl-[(1-ethyl-2,3,4,5-tetraphenylsilol-1-yl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 54515574 |
| Molecular Formula | C35H38Si2 |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | ethyl-[(1-ethyl-2,3,4,5-tetraphenylsilol-1-yl)methyl]-dimethylsilane |
| SMILES | CC[Si](C)(C)C[Si]1(CC)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C35H38Si2/c1-5-36(3,4)27-37(6-2)34(30-23-15-9-16-24-30)32(28-19-11-7-12-20-28)33(29-21-13-8-14-22-29)35(37)31-25-17-10-18-26-31/h7-26H,5-6,27H2,1-4H3 |
| InChIKey | YMEOZFZDVOIKCV-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|