C18H28Si2 — CID 54061388
(1-ethyl-1,3,4-trimethyl-5-phenylsilol-2-yl)-trimethylsilane (PubChem CID 54061388) has the molecular formula C18H28Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is (1-ethyl-1,3,4-trimethyl-5-phenylsilol-2-yl)-trimethylsilane.
| Compound Name | (1-ethyl-1,3,4-trimethyl-5-phenylsilol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 54061388 |
| Molecular Formula | C18H28Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1-ethyl-1,3,4-trimethyl-5-phenylsilol-2-yl)-trimethylsilane |
| SMILES | CC[Si]1(C)C(c2ccccc2)=C(C)C(C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C18H28Si2/c1-8-20(7)17(16-12-10-9-11-13-16)14(2)15(3)18(20)19(4,5)6/h9-13H,8H2,1-7H3 |
| InChIKey | LZYROWMJZJYOIB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|