C24H34Si — CID 163897080
ethane;1,1,2,5-tetramethyl-3,4-diphenylsilole (PubChem CID 163897080) has the molecular formula C24H34Si and a molecular weight of 350.62 g/mol. Its IUPAC name is ethane;1,1,2,5-tetramethyl-3,4-diphenylsilole.
| Compound Name | ethane;1,1,2,5-tetramethyl-3,4-diphenylsilole |
|---|---|
| PubChem CID | 163897080 |
| Molecular Formula | C24H34Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | ethane;1,1,2,5-tetramethyl-3,4-diphenylsilole |
| SMILES | CC.CC.CC1=C(c2ccccc2)C(c2ccccc2)=C(C)[Si]1(C)C |
| InChI | InChI=1S/C20H22Si.2C2H6/c1-15-19(17-11-7-5-8-12-17)20(16(2)21(15,3)4)18-13-9-6-10-14-18;2*1-2/h5-14H,1-4H3;2*1-2H3 |
| InChIKey | QGPBOMVFDYZKHB-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|