C42H50Si — CID 101405789
3,4-bis[2,6-di(propan-2-yl)phenyl]-1,1-dimethyl-2,5-diphenylsilole (PubChem CID 101405789) has the molecular formula C42H50Si and a molecular weight of 582.95 g/mol. Its IUPAC name is 3,4-bis[2,6-di(propan-2-yl)phenyl]-1,1-dimethyl-2,5-diphenylsilole.
| Compound Name | 3,4-bis[2,6-di(propan-2-yl)phenyl]-1,1-dimethyl-2,5-diphenylsilole |
|---|---|
| PubChem CID | 101405789 |
| Molecular Formula | C42H50Si |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | 3,4-bis[2,6-di(propan-2-yl)phenyl]-1,1-dimethyl-2,5-diphenylsilole |
| SMILES | CC(C)c1cccc(C(C)C)c1C1=C(c2ccccc2)[Si](C)(C)C(c2ccccc2)=C1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C42H50Si/c1-27(2)33-23-17-24-34(28(3)4)37(33)39-40(38-35(29(5)6)25-18-26-36(38)30(7)8)42(32-21-15-12-16-22-32)43(9,10)41(39)31-19-13-11-14-20-31/h11-30H,1-10H3 |
| InChIKey | RSMLSICAQRYDHY-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|