C46H36Si — CID 59133517
7-[3-(3,5-diphenylphenyl)phenyl]-1,1-dimethyl-2,3-diphenyl-1-benzosilole (PubChem CID 59133517) has the molecular formula C46H36Si and a molecular weight of 616.88 g/mol. Its IUPAC name is 7-[3-(3,5-diphenylphenyl)phenyl]-1,1-dimethyl-2,3-diphenyl-1-benzosilole.
| Compound Name | 7-[3-(3,5-diphenylphenyl)phenyl]-1,1-dimethyl-2,3-diphenyl-1-benzosilole |
|---|---|
| PubChem CID | 59133517 |
| Molecular Formula | C46H36Si |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 7-[3-(3,5-diphenylphenyl)phenyl]-1,1-dimethyl-2,3-diphenyl-1-benzosilole |
| SMILES | C[Si]1(C)C(c2ccccc2)=C(c2ccccc2)c2cccc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)c21 |
| InChI | InChI=1S/C46H36Si/c1-47(2)45(36-23-13-6-14-24-36)44(35-21-11-5-12-22-35)43-28-16-27-42(46(43)47)38-26-15-25-37(29-38)41-31-39(33-17-7-3-8-18-33)30-40(32-41)34-19-9-4-10-20-34/h3-32H,1-2H3 |
| InChIKey | IAJKGKNPHQLSAS-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|