C13H21ClOSi2 — CID 67759204
6-chloro-2,2,3,6-tetramethyl-3-phenyloxadisilinane (PubChem CID 67759204) has the molecular formula C13H21ClOSi2 and a molecular weight of 284.94 g/mol. Its IUPAC name is 6-chloro-2,2,3,6-tetramethyl-3-phenyloxadisilinane.
| Compound Name | 6-chloro-2,2,3,6-tetramethyl-3-phenyloxadisilinane |
|---|---|
| PubChem CID | 67759204 |
| Molecular Formula | C13H21ClOSi2 |
| Molecular Weight | 284.94 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-chloro-2,2,3,6-tetramethyl-3-phenyloxadisilinane |
| SMILES | CC1(Cl)CC[Si](C)(c2ccccc2)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H21ClOSi2/c1-13(14)10-11-17(4,16(2,3)15-13)12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | LUMQXZZEMJQOKO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|