C33H34OSi2 — CID 175604435
3,3-dimethyl-2,2-diphenyl-6,6-bis(2-phenylethenyl)oxadisilinane (PubChem CID 175604435) has the molecular formula C33H34OSi2 and a molecular weight of 502.81 g/mol. Its IUPAC name is 3,3-dimethyl-2,2-diphenyl-6,6-bis(2-phenylethenyl)oxadisilinane.
| Compound Name | 3,3-dimethyl-2,2-diphenyl-6,6-bis(2-phenylethenyl)oxadisilinane |
|---|---|
| PubChem CID | 175604435 |
| Molecular Formula | C33H34OSi2 |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3,3-dimethyl-2,2-diphenyl-6,6-bis(2-phenylethenyl)oxadisilinane |
| SMILES | C[Si]1(C)CCC(C=Cc2ccccc2)(C=Cc2ccccc2)O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34OSi2/c1-35(2)28-27-33(25-23-29-15-7-3-8-16-29,26-24-30-17-9-4-10-18-30)34-36(35,31-19-11-5-12-20-31)32-21-13-6-14-22-32/h3-26H,27-28H2,1-2H3 |
| InChIKey | SISKXZYDASPVSP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|