C14H18OSi — CID 10998823
2,2-dimethyl-6-[(E)-2-phenylethenyl]-3,4-dihydrooxasiline (PubChem CID 10998823) has the molecular formula C14H18OSi and a molecular weight of 230.38 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(E)-2-phenylethenyl]-3,4-dihydrooxasiline.
| Compound Name | 2,2-dimethyl-6-[(E)-2-phenylethenyl]-3,4-dihydrooxasiline |
|---|---|
| PubChem CID | 10998823 |
| Molecular Formula | C14H18OSi |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,2-dimethyl-6-[(E)-2-phenylethenyl]-3,4-dihydrooxasiline |
| SMILES | C[Si]1(C)CCC=C(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C14H18OSi/c1-16(2)12-6-9-14(15-16)11-10-13-7-4-3-5-8-13/h3-5,7-11H,6,12H2,1-2H3/b11-10+ |
| InChIKey | DKRBGKKCSYNXES-ZHACJKMWSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|