C16H18O — CID 164668676
(3S,3aS)-3-[(E)-2-phenylethenyl]-1,3,3a,4,5,6-hexahydro-2-benzofuran (PubChem CID 164668676) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (3S,3aS)-3-[(E)-2-phenylethenyl]-1,3,3a,4,5,6-hexahydro-2-benzofuran.
| Compound Name | (3S,3aS)-3-[(E)-2-phenylethenyl]-1,3,3a,4,5,6-hexahydro-2-benzofuran |
|---|---|
| PubChem CID | 164668676 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (3S,3aS)-3-[(E)-2-phenylethenyl]-1,3,3a,4,5,6-hexahydro-2-benzofuran |
| SMILES | C1=C2CO[C@@H](/C=C/c3ccccc3)[C@H]2CCC1 |
| InChI | InChI=1S/C16H18O/c1-2-6-13(7-3-1)10-11-16-15-9-5-4-8-14(15)12-17-16/h1-3,6-8,10-11,15-16H,4-5,9,12H2/b11-10+/t15-,16-/m0/s1 |
| InChIKey | OSZCFPCDHGLTCO-ISEXYEMMSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|