About 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide
5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide (PubChem CID 14085798) has the molecular formula C11H10O2S
and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide.
Molecular Properties
| Compound Name | 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide |
| PubChem CID | 14085798 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide |
| SMILES | O=S1C=C(/C=C/c2ccccc2)OC1 |
| InChI | InChI=1S/C11H10O2S/c12-14-8-11(13-9-14)7-6-10-4-2-1-3-5-10/h1-8H,9H2/b7-6+ |
| InChIKey | NLQDXSXKKWJMJS-VOTSOKGWSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide?
The IUPAC name of 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide (CID 14085798) is 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide.
What is the SMILES notation for 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide?
The canonical SMILES for 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide is O=S1C=C(/C=C/c2ccccc2)OC1.
What is the InChIKey of 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide?
The InChIKey is NLQDXSXKKWJMJS-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H10O2S/c12-14-8-11(13-9-14)7-6-10-4-2-1-3-5-10/h1-8H,9H2/b7-6+.
What are the key properties of 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide?
5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide has a molecular weight of 206.27 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-phenylethenyl]-1,3-oxathiole 3-oxide is sourced from PubChem (CID 14085798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).