C11H12O2S2 — CID 10421779
(1S,3S)-2-[(E)-2-phenylethenyl]-1,3-dithiolane 1,3-dioxide (PubChem CID 10421779) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1S,3S)-2-[(E)-2-phenylethenyl]-1,3-dithiolane 1,3-dioxide.
| Compound Name | (1S,3S)-2-[(E)-2-phenylethenyl]-1,3-dithiolane 1,3-dioxide |
|---|---|
| PubChem CID | 10421779 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (1S,3S)-2-[(E)-2-phenylethenyl]-1,3-dithiolane 1,3-dioxide |
| SMILES | O=[S@]1CC[S@](=O)C1/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H12O2S2/c12-14-8-9-15(13)11(14)7-6-10-4-2-1-3-5-10/h1-7,11H,8-9H2/b7-6+/t14-,15-/m0/s1 |
| InChIKey | ZQOPNZMFMXNVJL-KXLSMFKISA-N |
| XLogP | 1.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |