C17H20 — CID 102473410
(1E,3Z)-2-[(E)-2-phenylethenyl]cyclonona-1,3-diene (PubChem CID 102473410) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is (1E,3Z)-2-[(E)-2-phenylethenyl]cyclonona-1,3-diene.
| Compound Name | (1E,3Z)-2-[(E)-2-phenylethenyl]cyclonona-1,3-diene |
|---|---|
| PubChem CID | 102473410 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (1E,3Z)-2-[(E)-2-phenylethenyl]cyclonona-1,3-diene |
| SMILES | C1=C\C(\C=C\c2ccccc2)=C/CCCCC/1 |
| InChI | InChI=1S/C17H20/c1-2-4-7-11-16(10-6-3-1)14-15-17-12-8-5-9-13-17/h5-6,8-15H,1-4,7H2/b10-6-,15-14+,16-11+ |
| InChIKey | NYONLHVSZPQWOX-PCHVHXSUSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |