C14H14ClN — CID 57353442
1-chloro-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-amine (PubChem CID 57353442) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is 1-chloro-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-chloro-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 57353442 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-chloro-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1(Cl)C=CC(C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H14ClN/c15-14(16)10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-10H,11,16H2 |
| InChIKey | PQVAFSIIVICNNJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|