C34H29N — CID 70267811
N,N-diphenyl-1,4-bis[(E)-2-phenylethenyl]cyclohexa-2,4-dien-1-amine (PubChem CID 70267811) has the molecular formula C34H29N and a molecular weight of 451.61 g/mol. Its IUPAC name is N,N-diphenyl-1,4-bis[(E)-2-phenylethenyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | N,N-diphenyl-1,4-bis[(E)-2-phenylethenyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 70267811 |
| Molecular Formula | C34H29N |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N,N-diphenyl-1,4-bis[(E)-2-phenylethenyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C1=CC(/C=C/c2ccccc2)(N(c2ccccc2)c2ccccc2)CC=C1/C=C/c1ccccc1 |
| InChI | InChI=1S/C34H29N/c1-5-13-29(14-6-1)21-22-31-24-27-34(28-25-31,26-23-30-15-7-2-8-16-30)35(32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-27H,28H2/b22-21+,26-23+ |
| InChIKey | FZYUWDFLHOBXCL-OVSCGYIVSA-N |
| XLogP | 8.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |