C14H12Cl2 — CID 152771326
5,5-dichloro-2-(2-phenylethenyl)cyclohexa-1,3-diene (PubChem CID 152771326) has the molecular formula C14H12Cl2 and a molecular weight of 251.16 g/mol. Its IUPAC name is 5,5-dichloro-2-(2-phenylethenyl)cyclohexa-1,3-diene.
| Compound Name | 5,5-dichloro-2-(2-phenylethenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 152771326 |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5,5-dichloro-2-(2-phenylethenyl)cyclohexa-1,3-diene |
| SMILES | ClC1(Cl)C=CC(C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H12Cl2/c15-14(16)10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-10H,11H2 |
| InChIKey | IYBWGJNZODTIPX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|