C14H12O — CID 67648697
4-(2-phenylethenyl)cyclohexa-2,4-dien-1-one (PubChem CID 67648697) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(2-phenylethenyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 4-(2-phenylethenyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 67648697 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 4-(2-phenylethenyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H12O/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-10H,11H2 |
| InChIKey | QCSIIKZULREDHT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |