C12H14OS — CID 11469817
2-methyl-2-[(E)-2-phenylethenyl]-1,3-oxathiolane (PubChem CID 11469817) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-methyl-2-[(E)-2-phenylethenyl]-1,3-oxathiolane.
| Compound Name | 2-methyl-2-[(E)-2-phenylethenyl]-1,3-oxathiolane |
|---|---|
| PubChem CID | 11469817 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-methyl-2-[(E)-2-phenylethenyl]-1,3-oxathiolane |
| SMILES | CC1(/C=C/c2ccccc2)OCCS1 |
| InChI | InChI=1S/C12H14OS/c1-12(13-9-10-14-12)8-7-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3/b8-7+ |
| InChIKey | FVVIEVLOEYONMD-BQYQJAHWSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |