C17H16S2 — CID 11346649
2-phenyl-2-[(E)-2-phenylethenyl]-1,3-dithiolane (PubChem CID 11346649) has the molecular formula C17H16S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-phenyl-2-[(E)-2-phenylethenyl]-1,3-dithiolane.
| Compound Name | 2-phenyl-2-[(E)-2-phenylethenyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 11346649 |
| Molecular Formula | C17H16S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-phenyl-2-[(E)-2-phenylethenyl]-1,3-dithiolane |
| SMILES | C(=C/C1(c2ccccc2)SCCS1)\c1ccccc1 |
| InChI | InChI=1S/C17H16S2/c1-3-7-15(8-4-1)11-12-17(18-13-14-19-17)16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ |
| InChIKey | XNUPFJCITDHRAQ-VAWYXSNFSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |