C23H25BrO3S2 — CID 175919635
4-bromo-2-(4-phenylbuta-1,3-dienyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane (PubChem CID 175919635) has the molecular formula C23H25BrO3S2 and a molecular weight of 493.49 g/mol. Its IUPAC name is 4-bromo-2-(4-phenylbuta-1,3-dienyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane.
| Compound Name | 4-bromo-2-(4-phenylbuta-1,3-dienyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 175919635 |
| Molecular Formula | C23H25BrO3S2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 4-bromo-2-(4-phenylbuta-1,3-dienyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane |
| SMILES | COc1cc(C2(C=CC=Cc3ccccc3)SCCC(Br)S2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25BrO3S2/c1-25-19-15-18(16-20(26-2)22(19)27-3)23(28-14-12-21(24)29-23)13-8-7-11-17-9-5-4-6-10-17/h4-11,13,15-16,21H,12,14H2,1-3H3 |
| InChIKey | YVGMGDHCRLAPCI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|