C19H22O4 — CID 175119653
1,2,3-trimethoxy-5-[[(E)-3-phenylprop-2-enoxy]methyl]benzene (PubChem CID 175119653) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[[(E)-3-phenylprop-2-enoxy]methyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[[(E)-3-phenylprop-2-enoxy]methyl]benzene |
|---|---|
| PubChem CID | 175119653 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1,2,3-trimethoxy-5-[[(E)-3-phenylprop-2-enoxy]methyl]benzene |
| SMILES | COc1cc(COC/C=C/c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H22O4/c1-20-17-12-16(13-18(21-2)19(17)22-3)14-23-11-7-10-15-8-5-4-6-9-15/h4-10,12-13H,11,14H2,1-3H3/b10-7+ |
| InChIKey | JWWDCWZGPOQIHS-JXMROGBWSA-N |
| XLogP | 3.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|