C36H36O3 — CID 15531172
1,3,5-tris[[(E)-3-phenylprop-2-enoxy]methyl]benzene (PubChem CID 15531172) has the molecular formula C36H36O3 and a molecular weight of 516.68 g/mol. Its IUPAC name is 1,3,5-tris[[(E)-3-phenylprop-2-enoxy]methyl]benzene.
| Compound Name | 1,3,5-tris[[(E)-3-phenylprop-2-enoxy]methyl]benzene |
|---|---|
| PubChem CID | 15531172 |
| Molecular Formula | C36H36O3 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1,3,5-tris[[(E)-3-phenylprop-2-enoxy]methyl]benzene |
| SMILES | C(=C/c1ccccc1)\COCc1cc(COC/C=C/c2ccccc2)cc(COC/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C36H36O3/c1-4-13-31(14-5-1)19-10-22-37-28-34-25-35(29-38-23-11-20-32-15-6-2-7-16-32)27-36(26-34)30-39-24-12-21-33-17-8-3-9-18-33/h1-21,25-27H,22-24,28-30H2/b19-10+,20-11+,21-12+ |
| InChIKey | NPUDQPDFFKWBCZ-AUCPOXKISA-N |
| XLogP | 8.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|