C24H25Br3O3 — CID 10919097
1,3,5-tribromo-2-[[(E)-3-phenylprop-2-enoxy]methyl]-4,6-bis(prop-2-enoxymethyl)benzene (PubChem CID 10919097) has the molecular formula C24H25Br3O3 and a molecular weight of 601.17 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[[(E)-3-phenylprop-2-enoxy]methyl]-4,6-bis(prop-2-enoxymethyl)benzene.
| Compound Name | 1,3,5-tribromo-2-[[(E)-3-phenylprop-2-enoxy]methyl]-4,6-bis(prop-2-enoxymethyl)benzene |
|---|---|
| PubChem CID | 10919097 |
| Molecular Formula | C24H25Br3O3 |
| Molecular Weight | 601.17 g/mol |
| Exact Mass | 597.94 |
| IUPAC Name | 1,3,5-tribromo-2-[[(E)-3-phenylprop-2-enoxy]methyl]-4,6-bis(prop-2-enoxymethyl)benzene |
| SMILES | C=CCOCc1c(Br)c(COCC=C)c(Br)c(COC/C=C/c2ccccc2)c1Br |
| InChI | InChI=1S/C24H25Br3O3/c1-3-12-28-15-19-22(25)20(16-29-13-4-2)24(27)21(23(19)26)17-30-14-8-11-18-9-6-5-7-10-18/h3-11H,1-2,12-17H2/b11-8+ |
| InChIKey | NSPWZVITHVFMTN-DHZHZOJOSA-N |
| XLogP | 7.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.17 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|