C26H26N2O4 — CID 162647013
2,2-diphenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 162647013) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2,2-diphenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2,2-diphenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 162647013 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2,2-diphenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)C2CC2(c2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N2O4/c1-30-22-14-18(15-23(31-2)24(22)32-3)17-27-28-25(29)21-16-26(21,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,17,21H,16H2,1-3H3,(H,28,29)/b27-17+ |
| InChIKey | WDWWQYANTYCWIN-WPWMEQJKSA-N |
| XLogP | 4.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|