C60H58 — CID 173113756
1-[3,5-diphenyl-7-[(E)-2-phenylethenyl]-1-adamantyl]-3,5-diphenyl-7-[(E)-2-phenylethenyl]adamantane (PubChem CID 173113756) has the molecular formula C60H58 and a molecular weight of 779.12 g/mol. Its IUPAC name is 1-[3,5-diphenyl-7-[(E)-2-phenylethenyl]-1-adamantyl]-3,5-diphenyl-7-[(E)-2-phenylethenyl]adamantane.
| Compound Name | 1-[3,5-diphenyl-7-[(E)-2-phenylethenyl]-1-adamantyl]-3,5-diphenyl-7-[(E)-2-phenylethenyl]adamantane |
|---|---|
| PubChem CID | 173113756 |
| Molecular Formula | C60H58 |
| Molecular Weight | 779.12 g/mol |
| Exact Mass | 778.45 |
| IUPAC Name | 1-[3,5-diphenyl-7-[(E)-2-phenylethenyl]-1-adamantyl]-3,5-diphenyl-7-[(E)-2-phenylethenyl]adamantane |
| SMILES | C(=C/C12CC3(c4ccccc4)CC(c4ccccc4)(C1)CC(C14CC5(/C=C/c6ccccc6)CC(c6ccccc6)(CC(c6ccccc6)(C5)C1)C4)(C2)C3)\c1ccccc1 |
| InChI | InChI=1S/C60H58/c1-7-19-47(20-8-1)31-33-53-35-55(49-23-11-3-12-24-49)41-56(36-53,50-25-13-4-14-26-50)44-59(39-53,43-55)60-40-54(34-32-48-21-9-2-10-22-48)37-57(45-60,51-27-15-5-16-28-51)42-58(38-54,46-60)52-29-17-6-18-30-52/h1-34H,35-46H2/b33-31+,34-32+ |
| InChIKey | JXEQFFNHFOJXJY-FMWAKIAMSA-N |
| XLogP | 14.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.12 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |