C68H70 — CID 90766036
1-[3,5-bis(2-phenylethenyl)phenyl]-3-[3-[3,5-bis(2-phenylethenyl)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane (PubChem CID 90766036) has the molecular formula C68H70 and a molecular weight of 887.31 g/mol. Its IUPAC name is 1-[3,5-bis(2-phenylethenyl)phenyl]-3-[3-[3,5-bis(2-phenylethenyl)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane.
| Compound Name | 1-[3,5-bis(2-phenylethenyl)phenyl]-3-[3-[3,5-bis(2-phenylethenyl)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane |
|---|---|
| PubChem CID | 90766036 |
| Molecular Formula | C68H70 |
| Molecular Weight | 887.31 g/mol |
| Exact Mass | 886.55 |
| IUPAC Name | 1-[3,5-bis(2-phenylethenyl)phenyl]-3-[3-[3,5-bis(2-phenylethenyl)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane |
| SMILES | CC12CC3(C)CC(c4cc(C=Cc5ccccc5)cc(C=Cc5ccccc5)c4)(C1)CC(C14CC5(C)CC(C)(CC(c6cc(C=Cc7ccccc7)cc(C=Cc7ccccc7)c6)(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C68H70/c1-61-39-62(2)42-65(41-61,59-35-55(29-25-51-17-9-5-10-18-51)33-56(36-59)30-26-52-19-11-6-12-20-52)49-67(45-61,46-62)68-47-63(3)40-64(4,48-68)44-66(43-63,50-68)60-37-57(31-27-53-21-13-7-14-22-53)34-58(38-60)32-28-54-23-15-8-16-24-54/h5-38H,39-50H2,1-4H3 |
| InChIKey | WMMGMMQIRUZRMN-UHFFFAOYSA-N |
| XLogP | 18.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.31 |
| LogP ≤ 5 | 18.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|