C21H26O3 — CID 46210944
6-methyl-6-[(Z)-2-phenylethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 46210944) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-methyl-6-[(Z)-2-phenylethenyl]spiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | 6-methyl-6-[(Z)-2-phenylethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 46210944 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 6-methyl-6-[(Z)-2-phenylethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | CC1(/C=C\c2ccccc2)COC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C21H26O3/c1-20(8-7-15-5-3-2-4-6-15)14-22-21(24-23-20)18-10-16-9-17(12-18)13-19(21)11-16/h2-8,16-19H,9-14H2,1H3/b8-7- |
| InChIKey | QNNYKZVWFRANCG-FPLPWBNLSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|