C17H20OSi — CID 10901623
5,5-dimethyl-2,2-diphenyloxasilolane (PubChem CID 10901623) has the molecular formula C17H20OSi and a molecular weight of 268.43 g/mol. Its IUPAC name is 5,5-dimethyl-2,2-diphenyloxasilolane.
| Compound Name | 5,5-dimethyl-2,2-diphenyloxasilolane |
|---|---|
| PubChem CID | 10901623 |
| Molecular Formula | C17H20OSi |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5,5-dimethyl-2,2-diphenyloxasilolane |
| SMILES | CC1(C)CC[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H20OSi/c1-17(2)13-14-19(18-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | REULKWYDMXDCHO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|