C24H26O2Si — CID 175052859
2-ethoxy-2,6,6-triphenyloxasilinane (PubChem CID 175052859) has the molecular formula C24H26O2Si and a molecular weight of 374.56 g/mol. Its IUPAC name is 2-ethoxy-2,6,6-triphenyloxasilinane.
| Compound Name | 2-ethoxy-2,6,6-triphenyloxasilinane |
|---|---|
| PubChem CID | 175052859 |
| Molecular Formula | C24H26O2Si |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-ethoxy-2,6,6-triphenyloxasilinane |
| SMILES | CCO[Si]1(c2ccccc2)CCCC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C24H26O2Si/c1-2-25-27(23-17-10-5-11-18-23)20-12-19-24(26-27,21-13-6-3-7-14-21)22-15-8-4-9-16-22/h3-11,13-18H,2,12,19-20H2,1H3 |
| InChIKey | IBWHYRNLVPSGSX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|