2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen

C12H20O2Si — CID 173215327

IUPAC2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen
SMILESCC1(c2ccccc2)CCC[Si](C)(O)O1.[H][H]
InChIInChI=1S/C12H18O2Si.H2/c1-12(11-7-4-3-5-8-11)9-6-10-15(2,13)14-12;/h3-5,7-8,13H,6,9-10H2,1-2H3;1H
InChIKeyWOSJTNBOKSKRQO-UHFFFAOYSA-N
MW224.38 g/mol
LogP3.02
Rot. Bonds1

About 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen

2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen (PubChem CID 173215327) has the molecular formula C12H20O2Si and a molecular weight of 224.38 g/mol. Its IUPAC name is 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen.

Molecular Properties

Compound Name2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen
PubChem CID173215327
Molecular FormulaC12H20O2Si
Molecular Weight224.38 g/mol
Exact Mass224.12
IUPAC Name2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen
SMILESCC1(c2ccccc2)CCC[Si](C)(O)O1.[H][H]
InChIInChI=1S/C12H18O2Si.H2/c1-12(11-7-4-3-5-8-11)9-6-10-15(2,13)14-12;/h3-5,7-8,13H,6,9-10H2,1-2H3;1H
InChIKeyWOSJTNBOKSKRQO-UHFFFAOYSA-N
XLogP3.02
TPSA29.46 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.38
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen?
The IUPAC name of 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen (CID 173215327) is 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen.
What is the SMILES notation for 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen?
The canonical SMILES for 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen is CC1(c2ccccc2)CCC[Si](C)(O)O1.[H][H].
What is the InChIKey of 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen?
The InChIKey is WOSJTNBOKSKRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2Si.H2/c1-12(11-7-4-3-5-8-11)9-6-10-15(2,13)14-12;/h3-5,7-8,13H,6,9-10H2,1-2H3;1H.
What are the key properties of 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen?
2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen has a molecular weight of 224.38 g/mol, XLogP of 3.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen is sourced from PubChem (CID 173215327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).