C12H20O2Si — CID 173215327
2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen (PubChem CID 173215327) has the molecular formula C12H20O2Si and a molecular weight of 224.38 g/mol. Its IUPAC name is 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen.
| Compound Name | 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen |
|---|---|
| PubChem CID | 173215327 |
| Molecular Formula | C12H20O2Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-hydroxy-2,6-dimethyl-6-phenyloxasilinane;molecular hydrogen |
| SMILES | CC1(c2ccccc2)CCC[Si](C)(O)O1.[H][H] |
| InChI | InChI=1S/C12H18O2Si.H2/c1-12(11-7-4-3-5-8-11)9-6-10-15(2,13)14-12;/h3-5,7-8,13H,6,9-10H2,1-2H3;1H |
| InChIKey | WOSJTNBOKSKRQO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|