C14H20O4 — CID 134928493
(3R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-phenyldioxane (PubChem CID 134928493) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-phenyldioxane.
| Compound Name | (3R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-phenyldioxane |
|---|---|
| PubChem CID | 134928493 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-phenyldioxane |
| SMILES | CC(C)(OO)C1CC[C@](C)(c2ccccc2)OO1 |
| InChI | InChI=1S/C14H20O4/c1-13(2,17-15)12-9-10-14(3,18-16-12)11-7-5-4-6-8-11/h4-8,12,15H,9-10H2,1-3H3/t12?,14-/m1/s1 |
| InChIKey | DESGMXJFHYJVGU-TYZXPVIJSA-N |
| XLogP | 3.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|