C15H22O4 — CID 11108295
(3R,6R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-(4-methylphenyl)dioxane (PubChem CID 11108295) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3R,6R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-(4-methylphenyl)dioxane.
| Compound Name | (3R,6R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-(4-methylphenyl)dioxane |
|---|---|
| PubChem CID | 11108295 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3R,6R)-6-(2-hydroperoxypropan-2-yl)-3-methyl-3-(4-methylphenyl)dioxane |
| SMILES | Cc1ccc([C@@]2(C)CC[C@H](C(C)(C)OO)OO2)cc1 |
| InChI | InChI=1S/C15H22O4/c1-11-5-7-12(8-6-11)15(4)10-9-13(17-19-15)14(2,3)18-16/h5-8,13,16H,9-10H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | KNCWDEQIPPNDSE-UKRRQHHQSA-N |
| XLogP | 3.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|